Skip to article frontmatterSkip to article content
Site not loading correctly?

This may be due to an incorrect BASE_URL configuration. See the MyST Documentation for reference.

Linearized GR and Gravitational Waves

Universite Paris Saclay

Linearized Gravity with Sources and Gravitational Waves

1. Perturbation theory with sources

We consider a small perturbation around Minkowski spacetime:

gμν=ημν+hμν,hμν1.g_{\mu \nu} = \eta_{\mu \nu} + h_{\mu \nu}, \qquad |h_{\mu \nu}| \ll 1.

The linearized Einstein equation in the presence of a stress-energy tensor TμνT_{\mu\nu} (taken to be first order in perturbations) is:

Gμν(1)(hαβ)=8πGc4Tμν(1),G^{(1)}_{\mu \nu}(h_{\alpha \beta}) = \frac{8 \pi G}{c^4} T^{(1)}_{\mu \nu},

where Gμν(1)G^{(1)}_{\mu \nu} is the linearized Einstein tensor. At zeroth order, Gμν(ηαβ)=0G_{\mu \nu}(\eta_{\alpha \beta}) = 0 since Minkowski spacetime is a vacuum solution.

1.1 Trace-reversed perturbation

To simplify the left-hand side, we introduce the trace-reversed perturbation:

hˉμν=hμν12ημνh,h=ημνhμν,\bar h_{\mu \nu} = h_{\mu \nu} - \frac{1}{2} \eta_{\mu \nu} h, \qquad h = \eta^{\mu \nu} h_{\mu \nu},

which satisfies hˉ=h\bar h = -h.

1.2 Lorenz gauge condition

We impose the Lorenz gauge condition (also called harmonic gauge):

μhˉμν=0.\partial_\mu \bar h^{\mu \nu} = 0.

In this gauge, the linearized Einstein equation simplifies dramatically to a wave equation:

hˉμν=16πGc4Tμν,\square \bar h_{\mu \nu} = -\frac{16 \pi G}{c^4} T_{\mu \nu},

where =ημνμν\square = \eta^{\mu \nu} \partial_\mu \partial_\nu is the d’Alembertian operator, and we have dropped the superscript (1)(1) on TμνT_{\mu\nu} for simplicity.

1.3 Conservation of energy-momentum

The stress-energy tensor must satisfy the conservation equation μTμν=0\nabla_\mu T^{\mu \nu} = 0. To linear order, the Christoffel symbols are first-order in hh, so products ΓT\Gamma T are second-order and can be neglected. Thus:

μTμν=0.\partial_\mu T^{\mu \nu} = 0.

2. Gauge freedom and the transverse-traceless gauge

The Lorenz gauge condition (4) does not completely fix the coordinate invariance. There remains a residual gauge freedom: we can make an additional coordinate transformation xμxμ+ϵμx^\mu \to x^\mu + \epsilon^\mu with ϵν=0\square \epsilon^\nu = 0, which preserves the Lorenz condition.

We can use this freedom to impose two further conditions:

ihˉij=0(transverse condition),\partial^i \bar h_{ij} = 0 \quad \text{(transverse condition)},
hˉ=0(traceless condition).\bar h = 0 \quad \text{(traceless condition)}.

From the traceless condition hˉ=h=0\bar h = -h = 0, we obtain h=0h = 0, and consequently:

hˉμν=hμν.\bar h_{\mu \nu} = h_{\mu \nu}.

This combination of conditions (Lorenz + transverse + traceless) defines the transverse-traceless (TT) gauge.

3. Projection onto TT components

If hˉij\bar h_{ij} is a solution of (11), we obtain the physical transverse-traceless part hijTTh^{TT}_{ij} through a linear projection:

hijTT=Λijkl(n)hˉkl,h^{TT}_{ij} = \Lambda_{ij}^{\,\,\, kl}(\mathbf{n}) \, \bar h_{kl},

where n\mathbf{n} is the direction of propagation of the wave.

Define the transverse projection operator with respect to a unit vector n\mathbf{n}:

Pij(n)=δijninj.P_{ij}(\mathbf{n}) = \delta_{ij} - n_i n_j.

Properties:

The TT projection operator for a rank-2 tensor is:

Λijkl(n)=PikPjl12PijPkl.\Lambda_{ij}^{\,\,\, kl}(\mathbf{n}) = P_i^{\,k} P_j^{\,l} - \frac{1}{2} P_{ij} P^{kl}.

This operator extracts the transverse, traceless part of a symmetric tensor.

Solution to Exercise 2
  1. Λikli=PkiPil12PiiPkl=PklPkl=0\Lambda^i_{\, \, ikl} = P^i_k P_{il} - \dfrac{1}{2} P^i_i P_{kl} = P_{kl} - P_{kl} = 0

  2. PikPjlni12PijPklni=00=0P_{ik} P_{jl} n^i - \dfrac{1}{2} P_{ij} P_{kl} n^i = 0 - 0 = 0

We have

hijTT=Λijkl(n)hˉkl=PikhˉklPlj12Pij(Plkhˉkl)h^{TT}_{ij} = \Lambda_{ij}^{\,\,\, kl}(\mathbf{n}) \, \bar h_{kl} = P_{ik} \bar h^{kl} P_{lj} - \dfrac{1}{2} P_{ij} (P_{lk} \bar h^{kl})
Solution to Exercise 3
  • n=(010)Pij=(100010001)(000010000)=(100000001)\mathbf{n} = \begin{pmatrix} 0 \\ 1 \\ 0 \end{pmatrix} \Rightarrow P_{ij} = \begin{pmatrix} 1 & 0 & 0 \\ 0 & 1 & 0 \\ 0 & 0 & 1 \end{pmatrix} - \begin{pmatrix} 0 & 0 & 0 \\ 0 & 1 & 0 \\ 0 & 0 & 0 \end{pmatrix} = \begin{pmatrix} 1 & 0 & 0 \\ 0 & 0 & 0 \\ 0 & 0 & 1 \end{pmatrix}
  • PhP=(100000001)(h11h12h13h12h22h23h13h23h33)(100000001)=(h110h13000h130h33)\mathbf{P} \mathbf{h} \mathbf{P} = \begin{pmatrix} 1 & 0 & 0 \\ 0 & 0 & 0 \\ 0 & 0 & 1 \end{pmatrix} \begin{pmatrix} h_{11} & h_{12} & h_{13} \\ h_{12} & h_{22} & h_{23} \\ h_{13} & h_{23} & h_{33} \end{pmatrix} \begin{pmatrix} 1 & 0 & 0 \\ 0 & 0 & 0 \\ 0 & 0 & 1 \end{pmatrix} = \begin{pmatrix} h_{11} & 0 & h_{13} \\ 0 & 0 & 0 \\ h_{13} & 0 & h_{33} \end{pmatrix}
  • 12PTr(Ph)=(h11+h3320000000h11+h332)\dfrac{1}{2} \mathbf{P} \rm \, Tr(\mathbf{P} \mathbf{h}) = \begin{pmatrix} \dfrac{h_{11} + h_{33}}{2} & 0 & 0 \\ 0 & 0 & 0 \\ 0 & 0 & \dfrac{h_{11} + h_{33}}{2} \end{pmatrix}

So

hTT=(h11h3320h13000h130h11h332)\mathbf{h}^{TT} = \begin{pmatrix} \dfrac{h_{11} - h_{33}}{2} & 0 & h_{13} \\ 0 & 0 & 0 \\ h_{13} & 0 & -\dfrac{h_{11} - h_{33}}{2} \end{pmatrix}

This is indeed traceless and tranverse to y\mathbf{y}-direction.

4. Solution of the wave equation with source

Assume the source TijT_{ij} is localized in a region of characteristic size LL, and the detector is at a distance dd from the source, with dLd \gg L (far-field regime).

Geometry for gravitational wave emission: source localized near origin, detector at position \mathbf{x} = d \mathbf{n} with d \gg L.

Figure 1:Geometry for gravitational wave emission: source localized near origin, detector at position x=dn\mathbf{x} = d \mathbf{n} with dLd \gg L.

The solution to (5) is obtained using the retarded Green’s function:

hˉij(t,x)=4Gc4d3y1xyTij(txyc,y).\bar h_{ij}(t, \mathbf{x}) = \frac{4G}{c^4} \int d^3 y \, \frac{1}{|\mathbf{x} - \mathbf{y}|} \, T_{ij}\left(t - \frac{|\mathbf{x} - \mathbf{y}|}{c}, \mathbf{y}\right).

In the far-field limit dLd \gg L, we can approximate

xydny\begin{align*} |\mathbf{x} - \mathbf{y}| &\approx d - \mathbf{n} \cdot \mathbf{y} \end{align*}
Proof 1 (Expansion of xy|\mathbf{x} - \mathbf{y}|)
xy=x22xy+y2=d12xyd2+yd20d(12xyd2)1/2dny\begin{align*} |\mathbf{x} - \mathbf{y}| &= \sqrt{\mathbb{x}^2 - 2 \mathbf{x} \cdot \mathbf{y} + \mathbf{y}^2} \\ &= d \sqrt{1 - 2 \dfrac{\mathbf{x} \cdot \mathbf{y}}{d^2} + \underbrace{\dfrac{\mathbf{y}}{d^2}}_0} \\ &\approx d \left(1 - 2 \dfrac{\mathbf{x} \cdot \mathbf{y}}{d^2} \right)^{1/2} \\ &\approx d - \mathbf{n} \cdot \mathbf{y} \end{align*}

giving:

hˉij(t,x)4Gc4dd3yTij(trc+nyc,y).\bar h_{ij}(t, \mathbf{x}) \approx \frac{4G}{c^4 d} \int d^3 y \, T_{ij}\left(t - \frac{r}{c} + \frac{\mathbf{n} \cdot \mathbf{y}}{c}, \mathbf{y}\right).

Expanding in powers of ny/c\mathbf{n} \cdot \mathbf{y}/c (the slow-motion approximation) and using the conservation equations μTμν=0\partial_\mu T^{\mu\nu}=0, one can show that the leading contribution comes from the second moment (quadrupole) of the energy distribution. The result is the quadrupole formula:

Proof 2 (Quadrupole formula)
  • Expansion of TijT_{ij}

    Tij(txyc,y)=Tij(tdc,y)+ynctTij(tdc,y)+\begin{align*} T_{ij} \left( t - \dfrac{|\mathbf{x} - \mathbf{y}|}{c}, \mathbf{y} \right) &= T_{ij} \left( t - \dfrac{d}{c}, \mathbf{y} \right) + \dfrac{\mathbf{y} \cdot \mathbf{n}}{c} \partial_t T_{ij} \left( t - \dfrac{d}{c}, \mathbf{y} \right) + \dotsb \end{align*}
  • Characteristic time scale of the source

    tTijTijtc\partial_t T_{ij} \sim \dfrac{T_{ij}}{t_c}
  • Characteristic velocity

    vc=Ltcv_c = \dfrac{L}{t_c}
  • Approximation of TijT_{ij}, with y=L|\mathbf{y}| = L

    Tij+LcTijtc+=Tij(1+vcc+)T_{ij} + \dfrac{L}{c} \dfrac{T_{ij}}{t_c} + \dotsb = T_{ij}\left(1 + \dfrac{v_c}{c} + \dotsb \right)
  • Impose the non-relativistic (slow moving) source vccv_c \ll c

    hijTT(t,x)=Λijkl4Gc4dd3yTkl(tdc,y)\begin{align*} h^{TT}_{ij}(t, \mathbf{x}) &= \Lambda_{ij}^{kl} \dfrac{4 G}{c^4 d} \int d^3 \mathbf{y} T_{kl} \left(t - \dfrac{d}{c}, \mathbf{y} \right) \end{align*}
  • We define

    Iij(t)=d3yT00(t,y)yiyjI_{ij}(t) = \int d^3 \mathbf{y} \, T^{00}(t, \mathbf{y}) \, y_i \, y_j

    and

    Sij=d3yTij(t,y)S_{ij} = \int d^3 \mathbf{y} T_{ij}(t, \mathbf{y})
  • From equation of motion μTμν\partial_\mu T^{\mu \nu}, we have

    {0T00+kTk0=00T0j+kTkj=0{0T00=kTk00T0j=kTkj\begin{cases} \partial_0 T^{00} + \partial_k T^{k0} &= 0 \\ \partial_0 T^{0j} + \partial_k T^{kj} &= 0 \end{cases} \Rightarrow \begin{cases} \partial_0 T^{00} &= - \partial_k T^{k0} \\ \partial_0 T^{0j} &= - \partial_k T^{kj} \end{cases}
  • We have

    I˙ij=d3y0T00yiyj=d3ykTk0yiyj\begin{align*} \dot I_{ij} &= \int d^3 \mathbf{y} \partial_0 T^{00} \, y_i \, y_j \\ &= - \int d^3 \mathbf{y} \partial_k T^{k0} \, y_i \, y_j \end{align*}

    Integration by part

    I˙ij=d3yTk0[(kyi)yj+yi(kyj)]=d3yTk0[δkiyj+yiδkj]=d3y[Ti0yj+Tj0yi]\begin{align*} \dot I_{ij} &= \int d^3 \mathbf{y} T^{k0} [(\partial_k y_i) y_j + y_i (\partial_k y_j)] \\ &= \int d^3 \mathbf{y} T^{k0} [\delta_{ki} y_j + y_i \delta_{kj}] \\ &= \int d^3 \mathbf{y} [T_i^0 y_j + T_j^0 y_i] \end{align*}
  • Second derivative

    Iij¨=d3y[(0Ti0)yj+(0Tj0)yi]=d3y(kTkiyj+kTkjyi)=2Sij(Integral by part again!)\begin{align*} \ddot{I_{ij}} &= \int d^3 \mathbf{y} [(\partial_0 T^{i0}) y_j + (\partial_0 T^{j0})y_i] \\ &= - \int d^3 \mathbf{y} (\partial_k T^{ki} y_j + \partial_k T^{kj} y_i) \\ &= 2 S_{ij} \quad (\text{Integral by part again!}) \end{align*}

5. Application to a binary system in circular Kepler orbit

We now apply the linearized theory to the most important source of gravitational waves for ground‑based detectors: a compact binary system (two black holes or neutron stars) in a circular orbit.

5.1 Setup and definitions

Consider two point masses m1m_1 and m2m_2 in a circular Keplerian orbit.
Define the centre‑of‑mass frame with total mass M=m1+m2M = m_1 + m_2 and reduced mass μ=m1m2M\mu = \dfrac{m_1 m_2}{M}.
The relative separation vector is

r=y1y2,\mathbf{r} = \mathbf{y}_1 - \mathbf{y}_2,

and the individual positions are

y1=m2Mr,y2=m1Mr.\mathbf{y}_1 = \frac{m_2}{M}\mathbf{r},\qquad \mathbf{y}_2 = -\frac{m_1}{M}\mathbf{r}.

For a circular orbit of radius rr (constant) in the xxyy plane,

r(t)=r(cos(Ωt),  sin(Ωt),  0),\mathbf{r}(t) = r\bigl(\cos(\Omega t),\; \sin(\Omega t),\; 0\bigr),

with orbital angular frequency Ω=GM/r3\Omega = \sqrt{GM/r^{3}} (Kepler’s law).

5.2 Quadrupole moment and its second time derivative

The (mass) quadrupole moment is defined by

Iij(t)=d3y  T00(t,y)yiyj,I_{ij}(t) = \int d^3y\; T_{00}(t,\mathbf{y})\, y_i y_j,

where for point masses T00=ρT_{00} = \rho (in units with c=1c=1). Using the centre‑of‑mass relations,

Iij=m1y1iy1j+m2y2iy2j=μrirj.I_{ij} = m_1 y_{1i} y_{1j} + m_2 y_{2i} y_{2j} = \mu \, r_i r_j.

Thus

Iij(t)=12μr2(cos(2Ωt)sin(2Ωt)0sin(2Ωt)cos(2Ωt)0000).I_{ij}(t) = \dfrac{1}{2} \mu\, r^2 \begin{pmatrix} \cos (2\Omega t) & \sin(2\Omega t) & 0\\ \sin (2\Omega t) & -\cos(2 \Omega t) & 0\\ 0 & 0 & 0 \end{pmatrix}.
Proof 3 (Derivation of I¨ij\ddot I_{ij})

Starting from Iij=μrirjI_{ij} = \mu r_i r_j with r=r(cosΩt,sinΩt,0)\mathbf{r} = r(\cos\Omega t,\sin\Omega t,0):

I˙ij=μ(r˙irj+rir˙j),I¨ij=μ(r¨irj+rir¨j+2r˙ir˙j).\begin{aligned} \dot I_{ij} &= \mu(\dot r_i r_j + r_i \dot r_j),\\ \ddot I_{ij} &= \mu(\ddot r_i r_j + r_i \ddot r_j + 2\dot r_i \dot r_j). \end{aligned}

For circular motion,

r=r(cosθ,sinθ,0),r˙=rΩ(sinθ,cosθ,0),r¨=rΩ2(cosθ,sinθ,0),\mathbf{r} = r(\cos\theta,\sin\theta,0),\quad \dot{\mathbf{r}} = r\Omega(-\sin\theta,\cos\theta,0),\quad \ddot{\mathbf{r}} = -r\Omega^2(\cos\theta,\sin\theta,0),

with θ=Ωt\theta = \Omega t. Substituting:

  • For i=j=xi=j=x: I¨xx=μ[(rΩ2cosθ)(rcosθ)+(rcosθ)(rΩ2cosθ)+2(rΩ(sinθ))(rΩ(sinθ))]\ddot I_{xx} = \mu[(-r\Omega^2\cos\theta)(r\cos\theta) + (r\cos\theta)(-r\Omega^2\cos\theta) + 2(r\Omega(-\sin\theta))(r\Omega(-\sin\theta))]

    =μr2[Ω2cos2θΩ2cos2θ+2Ω2sin2θ]=2μr2Ω2(cos2θsin2θ)=2μr2Ω2cos2θ.= \mu r^2[-\Omega^2\cos^2\theta -\Omega^2\cos^2\theta + 2\Omega^2\sin^2\theta] = -2\mu r^2\Omega^2(\cos^2\theta - \sin^2\theta) = -2\mu r^2\Omega^2\cos2\theta.
  • For i=j=yi=j=y: similarly I¨yy=2μr2Ω2(sin2θcos2θ)=+2μr2Ω2cos2θ\ddot I_{yy} = -2\mu r^2\Omega^2(\sin^2\theta - \cos^2\theta) = +2\mu r^2\Omega^2\cos2\theta.

  • For i=x,j=yi=x,j=y: I¨xy=μ[(rΩ2cosθ)(rsinθ)+(rcosθ)(rΩ2sinθ)+2(rΩ(sinθ))(rΩcosθ)]\ddot I_{xy} = \mu[(-r\Omega^2\cos\theta)(r\sin\theta) + (r\cos\theta)(-r\Omega^2\sin\theta) + 2(r\Omega(-\sin\theta))(r\Omega\cos\theta)]

    =μr2[Ω2cosθsinθΩ2cosθsinθ2Ω2sinθcosθ]=4μr2Ω2cosθsinθ=2μr2Ω2sin2θ.= \mu r^2[-\Omega^2\cos\theta\sin\theta -\Omega^2\cos\theta\sin\theta - 2\Omega^2\sin\theta\cos\theta] = -4\mu r^2\Omega^2\cos\theta\sin\theta = -2\mu r^2\Omega^2\sin2\theta.

The remaining components vanish. This yields the matrix above.

5.3 Wave amplitude and the chirp mass

The non‑zero components of I¨ij\ddot I_{ij} oscillate with amplitude 2μr2Ω22\mu r^2 \Omega^2. For a face‑on binary, the wave amplitude (the magnitude of hijh_{ij}) is therefore

h0=2Gc4d(2μr2Ω2).h_0 = \frac{2G}{c^4 d}\, (2\mu r^2 \Omega^2).

We now eliminate rr using Kepler’s law Ω2=GM/r3\Omega^2 = GM/r^3. Solving for rr:

r=(GMΩ2)1/3.r = \left(\frac{GM}{\Omega^2}\right)^{1/3}.

Substituting into the amplitude:

h0=4Gμc4d(GMΩ2)2/3Ω2=4Gμc4d(GM)2/3Ω24/3=4Gμc4d(GM)2/3Ω2/3.h_0 = \frac{4G\mu}{c^4 d} \left(\frac{GM}{\Omega^2}\right)^{2/3} \Omega^2 = \frac{4G\mu}{c^4 d} (GM)^{2/3} \Omega^{2 - 4/3} = \frac{4G\mu}{c^4 d} (GM)^{2/3} \Omega^{2/3}.

It is convenient to introduce the chirp mass, which combines the two masses in a way that simplifies the expression:

M=(m1m2)3/5(m1+m2)1/5=μ3/5M2/5.\mathcal{M} = \frac{(m_1 m_2)^{3/5}}{(m_1+m_2)^{1/5}} = \mu^{3/5} M^{2/5}.

From this definition, we have μ=M5/3M2/3\mu = \mathcal{M}^{5/3} M^{-2/3}. Substituting into h0h_0:

h0=4Gc4dM5/3M2/3(GM)2/3Ω2/3=4Gc4dM5/3G2/3Ω2/3.h_0 = \frac{4G}{c^4 d} \mathcal{M}^{5/3} M^{-2/3} (GM)^{2/3} \Omega^{2/3} = \frac{4G}{c^4 d} \mathcal{M}^{5/3} G^{2/3} \Omega^{2/3}.

Finally, note that the gravitational wave frequency ff is twice the orbital frequency: f=Ω/πf = \Omega/\pi. Replacing Ω=πf\Omega = \pi f gives the standard form:

6. Energy carried by gravitational waves

Gravitational waves transport energy and cause the orbit of a binary system to shrink. However, because of the equivalence principle, one cannot define a local stress‑energy tensor for gravity, at any point one can choose a locally inertial frame where the gravitational field (and hence its energy) vanishes. Nevertheless, a meaningful averaged energy‑momentum pseudotensor can be constructed, provided the average is taken over several wavelengths of the radiation.

6.1 The stress‑energy pseudotensor

For a weak gravitational wave hμνh_{\mu\nu} propagating on a flat background, the effective stress‑energy tensor of the waves (in the transverse‑traceless gauge) is given by the Landau–Lifshitz or Isaacson averaged expression:

tμν=c432πGμhαβνhαβ,t_{\mu\nu} = \frac{c^4}{32\pi G}\, \big\langle \partial_\mu h_{\alpha\beta}\,\partial_\nu h^{\alpha\beta} \big\rangle,

where \langle \cdots \rangle denotes an average over a region large compared to the wavelength but small compared to the curvature scale. For a plane wave propagating in the zz direction, this yields an energy flux (the t0zt^{0z} component) proportional to the square of the time derivatives of the wave amplitudes.

6.2 Energy loss from a binary system

The quadrupole formula derived earlier gives the wave amplitude hijTTh^{TT}_{ij}. From it one can compute the total power (luminosity) carried away by gravitational waves. For a general source, the power is

PGW=G5c5I¨ijI¨ij,P_{\mathrm{GW}} = \frac{G}{5c^5} \big\langle \ddot I_{ij} \ddot I^{ij} \big\rangle,

where IijI_{ij} is the traceless quadrupole moment. For a binary in a circular orbit, using the expression for I¨ij\ddot I_{ij} and noting that I¨ij\ddot I_{ij} oscillates with frequency 2Ω2\Omega, one obtains after averaging over an orbit:

Proof 4 (Derivation of the power)

Starting from I¨ij\ddot I_{ij} (Eq. Second time derivative of the quadrupole moment), the traceless quadrupole is Iij=Iij13δijI  kkI_{ij} = I_{ij} - \frac{1}{3}\delta_{ij} I^k_{\;k}. For a binary in the xx-yy plane, I  kk=μr2I^k_{\;k} = \mu r^2, so

Iij=μr2(cos2Ωt13cosΩtsinΩt0cosΩtsinΩtsin2Ωt1300013).I_{ij} = \mu r^2 \begin{pmatrix} \cos^2\Omega t - \frac13 & \cos\Omega t\sin\Omega t & 0\\ \cos\Omega t\sin\Omega t & \sin^2\Omega t - \frac13 & 0\\ 0 & 0 & -\frac13 \end{pmatrix}.

Differentiating three times and averaging over an orbit (using cos22Ωt=sin22Ωt=12\langle \cos^2 2\Omega t\rangle = \langle \sin^2 2\Omega t\rangle = \frac12 and cos2Ωtsin2Ωt=0\langle \cos 2\Omega t\sin 2\Omega t\rangle = 0) yields

I¨ijI¨ij=325μ2r4Ω6.\big\langle \ddot I_{ij} \ddot I^{ij} \big\rangle = \frac{32}{5} \mu^2 r^4 \Omega^6.

Inserting r3=GM/Ω2r^3 = GM/\Omega^2 and μ=M5/3M2/3\mu = \mathcal{M}^{5/3} M^{-2/3} gives the second form in terms of M\mathcal{M} and Ω\Omega.

6.3 Orbital decay and the chirp formula

The total energy of the binary (in the Newtonian approximation) is

E=GμM2r.E = -\frac{G\mu M}{2r}.

As the system loses energy to gravitational waves, rr decreases and the orbital frequency increases. Equating the energy loss rate to the GW luminosity:

dEdt=PGW.-\frac{dE}{dt} = P_{\mathrm{GW}}.

Using dE/dr=+GμM2r2dE/dr = + \frac{G\mu M}{2r^2} (since EE is negative, its magnitude increases as rr decreases), we obtain

drdt=645G3μM2c5r3.\frac{dr}{dt} = -\frac{64}{5}\frac{G^3\mu M^2}{c^5 r^3}.

Now relate the gravitational wave frequency f=Ω/πf = \Omega/\pi to rr via Kepler’s law: f=1πGMr3f = \frac{1}{\pi}\sqrt{\frac{GM}{r^3}}. Differentiating with respect to time gives

dfdt=32πGMr5/2(drdt).\frac{df}{dt} = \frac{3}{2\pi}\sqrt{GM}\, r^{-5/2} \left(-\frac{dr}{dt}\right).

Substituting dr/dtdr/dt and expressing everything in terms of ff and the chirp mass M\mathcal{M} leads to the celebrated chirp formula:

Proof 5 (Derivation of the chirp formula)

Start from Kepler’s law: Ω2=GMr3\Omega^2 = \frac{GM}{r^3} with Ω=πf\Omega = \pi f. Hence

r=(GM(πf)2)1/3.r = \left(\frac{GM}{(\pi f)^2}\right)^{1/3}.

The binary energy is E=GμM2r=GμM2((πf)2GM)1/3E = -\frac{G\mu M}{2r} = -\frac{G\mu M}{2} \left(\frac{(\pi f)^2}{GM}\right)^{1/3}. Differentiate with respect to time:

dEdt=GμM213((πf)2GM)2/32π2fdfdt1GM=π23μ(GM(πf)2)2/3fdfdt.\frac{dE}{dt} = -\frac{G\mu M}{2} \cdot \frac{1}{3} \left(\frac{(\pi f)^2}{GM}\right)^{-2/3} \cdot 2\pi^2 f \frac{df}{dt} \cdot \frac{1}{GM} = -\frac{\pi^2}{3} \mu \left(\frac{GM}{(\pi f)^2}\right)^{2/3} f \frac{df}{dt}.

Now use the relation between μ\mu, MM and the chirp mass: μ=M5/3M2/3\mu = \mathcal{M}^{5/3} M^{-2/3}. Also note that (GM/(πf)2)2/3=(GM)2/3(πf)4/3(GM/(\pi f)^2)^{2/3} = (GM)^{2/3} (\pi f)^{-4/3}. Hence

dEdt=π23M5/3M2/3(GM)2/3(πf)4/3fdfdt=π24/33M5/3G2/3f14/3dfdt=13π2/3(GM)5/3f1/3dfdt.\frac{dE}{dt} = -\frac{\pi^2}{3} \mathcal{M}^{5/3} M^{-2/3} (GM)^{2/3} (\pi f)^{-4/3} f \frac{df}{dt} = -\frac{\pi^{2-4/3}}{3} \mathcal{M}^{5/3} G^{2/3} f^{1-4/3} \frac{df}{dt} = -\frac{1}{3} \pi^{2/3} (G\mathcal{M})^{5/3} f^{-1/3} \frac{df}{dt}.

Set this equal to the GW luminosity from Eq. Gravitational wave luminosity of a circular binary:

PGW=325c5G(GMΩc3)10/3=325c5G(GM)10/3(πf)10/3c10=325(GM)10/3(πf)10/31Gc5.P_{\mathrm{GW}} = \frac{32}{5} \frac{c^5}{G} \left(\frac{G\mathcal{M}\Omega}{c^3}\right)^{10/3} = \frac{32}{5} \frac{c^5}{G} (G\mathcal{M})^{10/3} (\pi f)^{10/3} c^{-10} = \frac{32}{5} (G\mathcal{M})^{10/3} (\pi f)^{10/3} \frac{1}{G c^5}.

Equating dE/dt=PGW-dE/dt = P_{\mathrm{GW}} (the minus sign because EE is negative and becomes more negative) gives

13π2/3(GM)5/3f1/3dfdt=325(GM)10/3(πf)10/31Gc5.\frac{1}{3} \pi^{2/3} (G\mathcal{M})^{5/3} f^{-1/3} \frac{df}{dt} = \frac{32}{5} (G\mathcal{M})^{10/3} (\pi f)^{10/3} \frac{1}{G c^5}.

Cancel a factor (GM)5/3(G\mathcal{M})^{5/3} and solve for df/dtdf/dt:

dfdt=3325(GM)5/3π10/32/3f10/3+1/31Gc5=965π8/3(GMc3)5/3f11/3.\frac{df}{dt} = 3 \cdot \frac{32}{5} (G\mathcal{M})^{5/3} \pi^{10/3 - 2/3} f^{10/3 + 1/3} \frac{1}{G c^5} = \frac{96}{5} \pi^{8/3} \left(\frac{G\mathcal{M}}{c^3}\right)^{5/3} f^{11/3}.

All factors of GG and cc now appear in the combination GM/c3G\mathcal{M}/c^3, which has dimensions of time (mass in geometric units).